C18H28ClN2O3+ — CID 161410080
[2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-triethylazanium (PubChem CID 161410080) has the molecular formula C18H28ClN2O3+ and a molecular weight of 355.89 g/mol. Its IUPAC name is [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-triethylazanium.
| Compound Name | [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 161410080 |
| Molecular Formula | C18H28ClN2O3+ |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [2-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-2-oxoethyl]-triethylazanium |
| SMILES | CCOC(=O)c1cc(Cl)cc(C)c1NC(=O)C[N+](CC)(CC)CC |
| InChI | InChI=1S/C18H27ClN2O3/c1-6-21(7-2,8-3)12-16(22)20-17-13(5)10-14(19)11-15(17)18(23)24-9-4/h10-11H,6-9,12H2,1-5H3/p+1 |
| InChIKey | PNAKKTJGENQNRX-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|