C15H24ClN2O2+ — CID 168796135
[2-(2-chloro-4-hydroxy-6-methylanilino)-2-oxoethyl]-triethylazanium (PubChem CID 168796135) has the molecular formula C15H24ClN2O2+ and a molecular weight of 299.82 g/mol. Its IUPAC name is [2-(2-chloro-4-hydroxy-6-methylanilino)-2-oxoethyl]-triethylazanium.
| Compound Name | [2-(2-chloro-4-hydroxy-6-methylanilino)-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 168796135 |
| Molecular Formula | C15H24ClN2O2+ |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2-(2-chloro-4-hydroxy-6-methylanilino)-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1c(C)cc(O)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O2/c1-5-18(6-2,7-3)10-14(20)17-15-11(4)8-12(19)9-13(15)16/h8-9H,5-7,10H2,1-4H3,(H-,17,19,20)/p+1 |
| InChIKey | CNTQTZSKEDIJHI-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|