C18H28N3O4+ — CID 155692839
methyl 5-methoxy-3-methyl-2-[[2-(methylamino)-2-(1-methylpyrrolidin-1-ium-1-yl)acetyl]amino]benzoate (PubChem CID 155692839) has the molecular formula C18H28N3O4+ and a molecular weight of 350.44 g/mol. Its IUPAC name is methyl 5-methoxy-3-methyl-2-[[2-(methylamino)-2-(1-methylpyrrolidin-1-ium-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 5-methoxy-3-methyl-2-[[2-(methylamino)-2-(1-methylpyrrolidin-1-ium-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 155692839 |
| Molecular Formula | C18H28N3O4+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl 5-methoxy-3-methyl-2-[[2-(methylamino)-2-(1-methylpyrrolidin-1-ium-1-yl)acetyl]amino]benzoate |
| SMILES | CNC(C(=O)Nc1c(C)cc(OC)cc1C(=O)OC)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C18H27N3O4/c1-12-10-13(24-4)11-14(18(23)25-5)15(12)20-17(22)16(19-2)21(3)8-6-7-9-21/h10-11,16,19H,6-9H2,1-5H3/p+1 |
| InChIKey | ITXWMMPDVLRIOI-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|