C22H28NO2Y+ — CID 158612693
1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-hydroxy-2,6-dimethylphenyl)propan-2-one;yttrium (PubChem CID 158612693) has the molecular formula C22H28NO2Y+ and a molecular weight of 427.38 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-hydroxy-2,6-dimethylphenyl)propan-2-one;yttrium.
| Compound Name | 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-hydroxy-2,6-dimethylphenyl)propan-2-one;yttrium |
|---|---|
| PubChem CID | 158612693 |
| Molecular Formula | C22H28NO2Y+ |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(1-benzylpyrrolidin-1-ium-1-yl)-3-(4-hydroxy-2,6-dimethylphenyl)propan-2-one;yttrium |
| SMILES | Cc1cc(O)cc(C)c1CC(=O)C[N+]1(Cc2ccccc2)CCCC1.[Y] |
| InChI | InChI=1S/C22H27NO2.Y/c1-17-12-20(24)13-18(2)22(17)14-21(25)16-23(10-6-7-11-23)15-19-8-4-3-5-9-19;/h3-5,8-9,12-13H,6-7,10-11,14-16H2,1-2H3;/p+1 |
| InChIKey | WMRJJZZWCSRCKZ-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|