C22H34NO3Y+ — CID 160556912
propyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate;yttrium (PubChem CID 160556912) has the molecular formula C22H34NO3Y+ and a molecular weight of 449.42 g/mol. Its IUPAC name is propyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate;yttrium.
| Compound Name | propyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate;yttrium |
|---|---|
| PubChem CID | 160556912 |
| Molecular Formula | C22H34NO3Y+ |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | propyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate;yttrium |
| SMILES | CCCOC(=O)C1CCC[N+](CC)(CC(=O)Cc2c(C)cccc2C)C1.[Y] |
| InChI | InChI=1S/C22H34NO3.Y/c1-5-13-26-22(25)19-11-8-12-23(6-2,15-19)16-20(24)14-21-17(3)9-7-10-18(21)4;/h7,9-10,19H,5-6,8,11-16H2,1-4H3;/q+1; |
| InChIKey | OJQQVSVLPPCZPM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|