C23H36NO3+ — CID 157113408
butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate (PubChem CID 157113408) has the molecular formula C23H36NO3+ and a molecular weight of 374.55 g/mol. Its IUPAC name is butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate.
| Compound Name | butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 157113408 |
| Molecular Formula | C23H36NO3+ |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate |
| SMILES | CCCCOC(=O)C1CCC[N+](CC)(CC(=O)Cc2c(C)cccc2C)C1 |
| InChI | InChI=1S/C23H36NO3/c1-5-7-14-27-23(26)20-12-9-13-24(6-2,16-20)17-21(25)15-22-18(3)10-8-11-19(22)4/h8,10-11,20H,5-7,9,12-17H2,1-4H3/q+1 |
| InChIKey | LBYGYWIYESJJPV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|