About butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate
butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate (PubChem CID 157113408) has the molecular formula C23H36NO3+
and a molecular weight of 374.55 g/mol. Its IUPAC name is butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate.
Molecular Properties
| Compound Name | butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate |
| PubChem CID | 157113408 |
| Molecular Formula | C23H36NO3+ |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate |
| SMILES | CCCCOC(=O)C1CCC[N+](CC)(CC(=O)Cc2c(C)cccc2C)C1 |
| InChI | InChI=1S/C23H36NO3/c1-5-7-14-27-23(26)20-12-9-13-24(6-2,16-20)17-21(25)15-22-18(3)10-8-11-19(22)4/h8,10-11,20H,5-7,9,12-17H2,1-4H3/q+1 |
| InChIKey | LBYGYWIYESJJPV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate?
The IUPAC name of butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate (CID 157113408) is butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate.
What is the SMILES notation for butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate?
The canonical SMILES for butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate is CCCCOC(=O)C1CCC[N+](CC)(CC(=O)Cc2c(C)cccc2C)C1.
What is the InChIKey of butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate?
The InChIKey is LBYGYWIYESJJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36NO3/c1-5-7-14-27-23(26)20-12-9-13-24(6-2,16-20)17-21(25)15-22-18(3)10-8-11-19(22)4/h8,10-11,20H,5-7,9,12-17H2,1-4H3/q+1.
What are the key properties of butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate?
butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate has a molecular weight of 374.55 g/mol, XLogP of 4.01, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-1-ethylpiperidin-1-ium-3-carboxylate is sourced from PubChem (CID 157113408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).