C23H31N2O+ — CID 155101169
N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)acetamide (PubChem CID 155101169) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 155101169 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)acetamide |
| SMILES | CC[N+]1(CC(=O)Nc2c(C)cccc2C)CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2O/c1-4-25(15-9-14-21(16-25)20-12-6-5-7-13-20)17-22(26)24-23-18(2)10-8-11-19(23)3/h5-8,10-13,21H,4,9,14-17H2,1-3H3/p+1 |
| InChIKey | ONUARAUKHUFPJF-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|