C20H32N3O2Y+ — CID 157330294
1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N,N-dimethylpiperidin-1-ium-3-carboxamide;yttrium (PubChem CID 157330294) has the molecular formula C20H32N3O2Y+ and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N,N-dimethylpiperidin-1-ium-3-carboxamide;yttrium.
| Compound Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N,N-dimethylpiperidin-1-ium-3-carboxamide;yttrium |
|---|---|
| PubChem CID | 157330294 |
| Molecular Formula | C20H32N3O2Y+ |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N,N-dimethylpiperidin-1-ium-3-carboxamide;yttrium |
| SMILES | CC[N+]1(CC(=O)Nc2c(C)cccc2C)CCCC(C(=O)N(C)C)C1.[Y] |
| InChI | InChI=1S/C20H31N3O2.Y/c1-6-23(12-8-11-17(13-23)20(25)22(4)5)14-18(24)21-19-15(2)9-7-10-16(19)3;/h7,9-10,17H,6,8,11-14H2,1-5H3;/p+1 |
| InChIKey | VGTRGUCLUBXIOK-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|