C23H30NOY+ — CID 159400657
1-(1-benzylpiperidin-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one;yttrium (PubChem CID 159400657) has the molecular formula C23H30NOY+ and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one;yttrium.
| Compound Name | 1-(1-benzylpiperidin-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one;yttrium |
|---|---|
| PubChem CID | 159400657 |
| Molecular Formula | C23H30NOY+ |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one;yttrium |
| SMILES | Cc1cccc(C)c1CC(=O)C[N+]1(Cc2ccccc2)CCCCC1.[Y] |
| InChI | InChI=1S/C23H30NO.Y/c1-19-10-9-11-20(2)23(19)16-22(25)18-24(14-7-4-8-15-24)17-21-12-5-3-6-13-21;/h3,5-6,9-13H,4,7-8,14-18H2,1-2H3;/q+1; |
| InChIKey | ZWFLOFUKOSSDFG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|