C25H33F3N2O2 — CID 155100192
N-[2-(1-benzylazepan-1-ium-1-yl)ethyl]-2,6-dimethylaniline;2,2,2-trifluoroacetate (PubChem CID 155100192) has the molecular formula C25H33F3N2O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is N-[2-(1-benzylazepan-1-ium-1-yl)ethyl]-2,6-dimethylaniline;2,2,2-trifluoroacetate.
| Compound Name | N-[2-(1-benzylazepan-1-ium-1-yl)ethyl]-2,6-dimethylaniline;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155100192 |
| Molecular Formula | C25H33F3N2O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-[2-(1-benzylazepan-1-ium-1-yl)ethyl]-2,6-dimethylaniline;2,2,2-trifluoroacetate |
| SMILES | Cc1cccc(C)c1NCC[N+]1(Cc2ccccc2)CCCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H33N2.C2HF3O2/c1-20-11-10-12-21(2)23(20)24-15-18-25(16-8-3-4-9-17-25)19-22-13-6-5-7-14-22;3-2(4,5)1(6)7/h5-7,10-14,24H,3-4,8-9,15-19H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | GMTYFPQPJPDYRQ-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|