C24H32BrNO — CID 159037785
1-(1-benzylazepan-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one bromide (PubChem CID 159037785) has the molecular formula C24H32BrNO and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-(1-benzylazepan-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one bromide.
| Compound Name | 1-(1-benzylazepan-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one bromide |
|---|---|
| PubChem CID | 159037785 |
| Molecular Formula | C24H32BrNO |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(1-benzylazepan-1-ium-1-yl)-3-(2,6-dimethylphenyl)propan-2-one bromide |
| SMILES | Cc1cccc(C)c1CC(=O)C[N+]1(Cc2ccccc2)CCCCCC1.[Br-] |
| InChI | InChI=1S/C24H32NO.BrH/c1-20-11-10-12-21(2)24(20)17-23(26)19-25(15-8-3-4-9-16-25)18-22-13-6-5-7-14-22;/h5-7,10-14H,3-4,8-9,15-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IBUDDUADSCIPRK-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|