C26H39N2O4+ — CID 161069042
methyl 2-[3-[3-(cyclohexylcarbamoyl)-1-ethylpiperidin-1-ium-1-yl]-2-oxopropyl]-3-methylbenzoate (PubChem CID 161069042) has the molecular formula C26H39N2O4+ and a molecular weight of 443.61 g/mol. Its IUPAC name is methyl 2-[3-[3-(cyclohexylcarbamoyl)-1-ethylpiperidin-1-ium-1-yl]-2-oxopropyl]-3-methylbenzoate.
| Compound Name | methyl 2-[3-[3-(cyclohexylcarbamoyl)-1-ethylpiperidin-1-ium-1-yl]-2-oxopropyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 161069042 |
| Molecular Formula | C26H39N2O4+ |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | methyl 2-[3-[3-(cyclohexylcarbamoyl)-1-ethylpiperidin-1-ium-1-yl]-2-oxopropyl]-3-methylbenzoate |
| SMILES | CC[N+]1(CC(=O)Cc2c(C)cccc2C(=O)OC)CCCC(C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C26H38N2O4/c1-4-28(15-9-11-20(17-28)25(30)27-21-12-6-5-7-13-21)18-22(29)16-24-19(2)10-8-14-23(24)26(31)32-3/h8,10,14,20-21H,4-7,9,11-13,15-18H2,1-3H3/p+1 |
| InChIKey | UEKJFYCDYBNNPB-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|