C15H15Cl2N3O — CID 107653033
1-(4-amino-2,6-dimethylphenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107653033) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 1-(4-amino-2,6-dimethylphenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(4-amino-2,6-dimethylphenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107653033 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(4-amino-2,6-dimethylphenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | Cc1cc(N)cc(C)c1NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-8-3-12(18)4-9(2)14(8)20-15(21)19-13-6-10(16)5-11(17)7-13/h3-7H,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | SHNFYVQLNOUSGM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|