C15H14Cl2N2O2 — CID 107653706
1-(3,5-dichlorophenyl)-3-(4-hydroxy-2,5-dimethylphenyl)urea (PubChem CID 107653706) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(4-hydroxy-2,5-dimethylphenyl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(4-hydroxy-2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 107653706 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(4-hydroxy-2,5-dimethylphenyl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc(Cl)cc(Cl)c2)c(C)cc1O |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-8-4-14(20)9(2)3-13(8)19-15(21)18-12-6-10(16)5-11(17)7-12/h3-7,20H,1-2H3,(H2,18,19,21) |
| InChIKey | QFBLYSSDTJQJAX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|