C14H10Cl4N2O3S — CID 28636075
3-chloro-4-(methanesulfonamido)-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 28636075) has the molecular formula C14H10Cl4N2O3S and a molecular weight of 428.12 g/mol. Its IUPAC name is 3-chloro-4-(methanesulfonamido)-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 3-chloro-4-(methanesulfonamido)-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 28636075 |
| Molecular Formula | C14H10Cl4N2O3S |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 3-chloro-4-(methanesulfonamido)-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl4N2O3S/c1-24(22,23)20-12-3-2-7(4-10(12)17)14(21)19-13-6-9(16)8(15)5-11(13)18/h2-6,20H,1H3,(H,19,21) |
| InChIKey | IGBAHDUPCJOMDS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|