C19H21ClN2O5S — CID 92686022
butyl 4-[[3-chloro-4-(methanesulfonamido)benzoyl]amino]benzoate (PubChem CID 92686022) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is butyl 4-[[3-chloro-4-(methanesulfonamido)benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[3-chloro-4-(methanesulfonamido)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 92686022 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | butyl 4-[[3-chloro-4-(methanesulfonamido)benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(NS(C)(=O)=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-3-4-11-27-19(24)13-5-8-15(9-6-13)21-18(23)14-7-10-17(16(20)12-14)22-28(2,25)26/h5-10,12,22H,3-4,11H2,1-2H3,(H,21,23) |
| InChIKey | WZXCXJJKUXSDDL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|