C17H19ClN2O4S — CID 5144321
N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,2-dimethylpropanamide (PubChem CID 5144321) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 5144321 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[5-[(2-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(S(=O)(=O)Nc2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C17H19ClN2O4S/c1-17(2,3)16(22)19-14-10-11(8-9-15(14)21)25(23,24)20-13-7-5-4-6-12(13)18/h4-10,20-21H,1-3H3,(H,19,22) |
| InChIKey | ILQFRIYKDMYQOG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|