C23H21ClN2O6S — CID 42930090
6-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 42930090) has the molecular formula C23H21ClN2O6S and a molecular weight of 488.95 g/mol. Its IUPAC name is 6-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 42930090 |
| Molecular Formula | C23H21ClN2O6S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 6-chloro-N-[2-hydroxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(O)c(NC(=O)C2COc3ccc(Cl)cc3C2)c1 |
| InChI | InChI=1S/C23H21ClN2O6S/c1-31-22-5-3-2-4-18(22)26-33(29,30)17-7-8-20(27)19(12-17)25-23(28)15-10-14-11-16(24)6-9-21(14)32-13-15/h2-9,11-12,15,26-27H,10,13H2,1H3,(H,25,28) |
| InChIKey | VCUXGCCWFIMQEC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|