C21H16ClN3O8S — CID 3907213
[2-(2-nitroanilino)-2-oxoethyl] 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate (PubChem CID 3907213) has the molecular formula C21H16ClN3O8S and a molecular weight of 505.89 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 3907213 |
| Molecular Formula | C21H16ClN3O8S |
| Molecular Weight | 505.89 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 5-[(2-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccccc2Cl)ccc1O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16ClN3O8S/c22-15-5-1-2-6-16(15)24-34(31,32)13-9-10-19(26)14(11-13)21(28)33-12-20(27)23-17-7-3-4-8-18(17)25(29)30/h1-11,24,26H,12H2,(H,23,27) |
| InChIKey | ITLAYRCFKCDCPE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|