C12H14BrNO2S — CID 95588085
[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-bromothiophen-2-yl)methanone (PubChem CID 95588085) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-bromothiophen-2-yl)methanone.
| Compound Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-bromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 95588085 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(4-bromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCO[C@@H]2CCC[C@H]21 |
| InChI | InChI=1S/C12H14BrNO2S/c13-8-6-11(17-7-8)12(15)14-4-5-16-10-3-1-2-9(10)14/h6-7,9-10H,1-5H2/t9-,10-/m1/s1 |
| InChIKey | GCVCTEWJKMHBLD-NXEZZACHSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |