C13H16BrNO2S — CID 56820517
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-bromothiophen-2-yl)methanone (PubChem CID 56820517) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-bromothiophen-2-yl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-bromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 56820517 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-bromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C13H16BrNO2S/c14-9-7-12(18-8-9)13(16)15-5-6-17-11-4-2-1-3-10(11)15/h7-8,10-11H,1-6H2 |
| InChIKey | JZBUSVLVIUIYSZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |