C14H17NO4S2 — CID 110308338
(E)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 110308338) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 110308338 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (E)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | C/C(=C\c1cccs1)C(=O)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C14H17NO4S2/c1-10(7-11-3-2-6-20-11)14(16)15-4-5-19-13-9-21(17,18)8-12(13)15/h2-3,6-7,12-13H,4-5,8-9H2,1H3/b10-7+ |
| InChIKey | KVPVUXOIDKLDQC-JXMROGBWSA-N |
| XLogP | 1.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|