C17H17NOS — CID 110298524
(E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 110298524) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 110298524 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (E)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | C/C(=C\c1cccs1)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H17NOS/c1-13(11-16-7-4-10-20-16)17(19)18-9-8-14-5-2-3-6-15(14)12-18/h2-7,10-11H,8-9,12H2,1H3/b13-11+ |
| InChIKey | CEJPGFYBZMIITP-ACCUITESSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|