C16H18N4OS — CID 110298550
(E)-2-methyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 110298550) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is (E)-2-methyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-2-methyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 110298550 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (E)-2-methyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | C/C(=C\c1cccs1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H18N4OS/c1-13(12-14-4-2-11-22-14)15(21)19-7-9-20(10-8-19)16-17-5-3-6-18-16/h2-6,11-12H,7-10H2,1H3/b13-12+ |
| InChIKey | FPGKJAIDAKFQOG-OUKQBFOZSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|