C14H15N5O2S — CID 110866230
4-pyrimidin-2-yl-N-(thiophene-2-carbonyl)piperazine-1-carboxamide (PubChem CID 110866230) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N-(thiophene-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | 4-pyrimidin-2-yl-N-(thiophene-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110866230 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-pyrimidin-2-yl-N-(thiophene-2-carbonyl)piperazine-1-carboxamide |
| SMILES | O=C(NC(=O)N1CCN(c2ncccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C14H15N5O2S/c20-12(11-3-1-10-22-11)17-14(21)19-8-6-18(7-9-19)13-15-4-2-5-16-13/h1-5,10H,6-9H2,(H,17,20,21) |
| InChIKey | UOCGOCSLOXNQJJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |