C16H21N5OS — CID 60547485
4-pyrimidin-2-yl-N-(1-thiophen-2-ylpropyl)piperazine-1-carboxamide (PubChem CID 60547485) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N-(1-thiophen-2-ylpropyl)piperazine-1-carboxamide.
| Compound Name | 4-pyrimidin-2-yl-N-(1-thiophen-2-ylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60547485 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-pyrimidin-2-yl-N-(1-thiophen-2-ylpropyl)piperazine-1-carboxamide |
| SMILES | CCC(NC(=O)N1CCN(c2ncccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C16H21N5OS/c1-2-13(14-5-3-12-23-14)19-16(22)21-10-8-20(9-11-21)15-17-6-4-7-18-15/h3-7,12-13H,2,8-11H2,1H3,(H,19,22) |
| InChIKey | SZPYNEBJPZWZJF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |