C23H33N5O — CID 42934794
N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 42934794) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42934794 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N-[1-(4-butan-2-ylphenyl)-2-methylpropyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | CCC(C)c1ccc(C(NC(=O)N2CCN(c3ncccn3)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C23H33N5O/c1-5-18(4)19-7-9-20(10-8-19)21(17(2)3)26-23(29)28-15-13-27(14-16-28)22-24-11-6-12-25-22/h6-12,17-18,21H,5,13-16H2,1-4H3,(H,26,29) |
| InChIKey | CQKYFNMPOCOXEC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |