C22H24N6O2S — CID 55933838
N-[4-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 55933838) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[4-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55933838 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[4-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCN1CCN(c2ncccn2)CC1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H24N6O2S/c29-20(17-4-6-18(7-5-17)26-21(30)19-3-1-16-31-19)23-10-11-27-12-14-28(15-13-27)22-24-8-2-9-25-22/h1-9,16H,10-15H2,(H,23,29)(H,26,30) |
| InChIKey | CJTBSKWUEHALII-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |