C16H19N5O2S — CID 112994685
N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 112994685) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 112994685 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H19N5O2S/c22-14(11-13-3-1-10-24-13)19-12-15(23)20-6-8-21(9-7-20)16-17-4-2-5-18-16/h1-5,10H,6-9,11-12H2,(H,19,22) |
| InChIKey | QXXKYNFKECSMGF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |