C10H13NOS — CID 14383806
(E)-N,N,2-trimethyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 14383806) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (E)-N,N,2-trimethyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N,N,2-trimethyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 14383806 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (E)-N,N,2-trimethyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cccs1)C(=O)N(C)C |
| InChI | InChI=1S/C10H13NOS/c1-8(10(12)11(2)3)7-9-5-4-6-13-9/h4-7H,1-3H3/b8-7+ |
| InChIKey | PORBOFMTWOIVFS-BQYQJAHWSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|