C15H21NO3S2 — CID 110617380
(E)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 110617380) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (E)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 110617380 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (E)-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cccs1)C(=O)NCCCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO3S2/c1-12(10-14-5-3-8-20-14)15(17)16-7-2-4-13-6-9-21(18,19)11-13/h3,5,8,10,13H,2,4,6-7,9,11H2,1H3,(H,16,17)/b12-10+ |
| InChIKey | MZMBAKWVABVPIL-ZRDIBKRKSA-N |
| XLogP | 2.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|