C18H17N3OS2 — CID 110305236
(E)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 110305236) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is (E)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 110305236 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (E)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cccs1)C(=O)NCCc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H17N3OS2/c1-13(11-16-3-2-10-23-16)17(22)20-9-6-15-12-24-18(21-15)14-4-7-19-8-5-14/h2-5,7-8,10-12H,6,9H2,1H3,(H,20,22)/b13-11+ |
| InChIKey | MEEUBCHDCRNQST-ACCUITESSA-N |
| XLogP | 4.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|