C20H18FN3OS — CID 110305238
(E)-3-(2-fluorophenyl)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]prop-2-enamide (PubChem CID 110305238) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 110305238 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-2-methyl-N-[2-(2-pyridin-4-yl-1,3-thiazol-4-yl)ethyl]prop-2-enamide |
| SMILES | C/C(=C\c1ccccc1F)C(=O)NCCc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C20H18FN3OS/c1-14(12-16-4-2-3-5-18(16)21)19(25)23-11-8-17-13-26-20(24-17)15-6-9-22-10-7-15/h2-7,9-10,12-13H,8,11H2,1H3,(H,23,25)/b14-12+ |
| InChIKey | GXOLTBQZGVOYKP-WYMLVPIESA-N |
| XLogP | 4.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|