C18H22N2O3S2 — CID 110616998
(E)-N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 110616998) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (E)-N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 110616998 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (E)-N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cccs1)C(=O)NCCCc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-14(13-17-6-4-12-24-17)18(21)19-11-3-5-15-7-9-16(10-8-15)20-25(2,22)23/h4,6-10,12-13,20H,3,5,11H2,1-2H3,(H,19,21)/b14-13+ |
| InChIKey | VLSIIBYQAJSFMO-BUHFOSPRSA-N |
| XLogP | 3.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|