C20H24Cl2N2O3 — CID 94103130
[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2R)-1-(2,5-dichlorobenzoyl)pyrrolidin-2-yl]methanone (PubChem CID 94103130) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2R)-1-(2,5-dichlorobenzoyl)pyrrolidin-2-yl]methanone.
| Compound Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2R)-1-(2,5-dichlorobenzoyl)pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 94103130 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-[(2R)-1-(2,5-dichlorobenzoyl)pyrrolidin-2-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCC[C@@H]1C(=O)N1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H24Cl2N2O3/c21-13-7-8-15(22)14(12-13)19(25)23-9-3-5-17(23)20(26)24-10-11-27-18-6-2-1-4-16(18)24/h7-8,12,16-18H,1-6,9-11H2/t16-,17+,18-/m0/s1 |
| InChIKey | OGZDZKXHQKZCSV-KSZLIROESA-N |
| XLogP | 3.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |