C13H16BrF2NO2S — CID 104968320
(2S,6R)-1-(2-bromo-4,6-difluorophenyl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 104968320) has the molecular formula C13H16BrF2NO2S and a molecular weight of 368.24 g/mol. Its IUPAC name is (2S,6R)-1-(2-bromo-4,6-difluorophenyl)sulfonyl-2,6-dimethylpiperidine.
| Compound Name | (2S,6R)-1-(2-bromo-4,6-difluorophenyl)sulfonyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 104968320 |
| Molecular Formula | C13H16BrF2NO2S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | (2S,6R)-1-(2-bromo-4,6-difluorophenyl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C13H16BrF2NO2S/c1-8-4-3-5-9(2)17(8)20(18,19)13-11(14)6-10(15)7-12(13)16/h6-9H,3-5H2,1-2H3/t8-,9+ |
| InChIKey | KXTNEYQYRRJHSN-DTORHVGOSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |