C11H13BrF2N2O2S — CID 62063051
[1-(2-bromo-4,6-difluorophenyl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 62063051) has the molecular formula C11H13BrF2N2O2S and a molecular weight of 355.20 g/mol. Its IUPAC name is [1-(2-bromo-4,6-difluorophenyl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2-bromo-4,6-difluorophenyl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 62063051 |
| Molecular Formula | C11H13BrF2N2O2S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | [1-(2-bromo-4,6-difluorophenyl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2c(F)cc(F)cc2Br)C1 |
| InChI | InChI=1S/C11H13BrF2N2O2S/c12-9-3-8(13)4-10(14)11(9)19(17,18)16-2-1-7(5-15)6-16/h3-4,7H,1-2,5-6,15H2 |
| InChIKey | WUOQWVYZMYGTNH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |