C10H9BrF3NO2S — CID 80668908
3-bromo-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidine (PubChem CID 80668908) has the molecular formula C10H9BrF3NO2S and a molecular weight of 344.15 g/mol. Its IUPAC name is 3-bromo-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-bromo-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 80668908 |
| Molecular Formula | C10H9BrF3NO2S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 3-bromo-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1c(F)cc(F)cc1F)N1CCC(Br)C1 |
| InChI | InChI=1S/C10H9BrF3NO2S/c11-6-1-2-15(5-6)18(16,17)10-8(13)3-7(12)4-9(10)14/h3-4,6H,1-2,5H2 |
| InChIKey | DZYABZQNRGFSOH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|