C10H11F3N2O2S — CID 55029986
1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 55029986) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | 1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 55029986 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | NC1CCN(S(=O)(=O)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C10H11F3N2O2S/c11-6-3-8(12)10(9(13)4-6)18(16,17)15-2-1-7(14)5-15/h3-4,7H,1-2,5,14H2 |
| InChIKey | QNSRHLQXZWYBFA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |