C10H12ClF3N2O2S — CID 119962604
(3R)-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119962604) has the molecular formula C10H12ClF3N2O2S and a molecular weight of 316.73 g/mol. Its IUPAC name is (3R)-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962604 |
| Molecular Formula | C10H12ClF3N2O2S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (3R)-1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(S(=O)(=O)c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C10H11F3N2O2S.ClH/c11-6-3-8(12)10(9(13)4-6)18(16,17)15-2-1-7(14)5-15;/h3-4,7H,1-2,5,14H2;1H/t7-;/m1./s1 |
| InChIKey | XYCSXJZXKFDJTD-OGFXRTJISA-N |
| XLogP | 1.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |