C12H12BrF2NO3S — CID 63846387
1-(2-bromo-4,6-difluorophenyl)sulfonylpiperidine-2-carbaldehyde (PubChem CID 63846387) has the molecular formula C12H12BrF2NO3S and a molecular weight of 368.20 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)sulfonylpiperidine-2-carbaldehyde.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)sulfonylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 63846387 |
| Molecular Formula | C12H12BrF2NO3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)sulfonylpiperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1S(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H12BrF2NO3S/c13-10-5-8(14)6-11(15)12(10)20(18,19)16-4-2-1-3-9(16)7-17/h5-7,9H,1-4H2 |
| InChIKey | QBYRPSUCPKRGIR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|