C12H15F3N2O2S — CID 115312594
2-methyl-1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-amine (PubChem CID 115312594) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-methyl-1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-amine.
| Compound Name | 2-methyl-1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 115312594 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-methyl-1-(2,4,6-trifluorophenyl)sulfonylpiperidin-4-amine |
| SMILES | CC1CC(N)CCN1S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O2S/c1-7-4-9(16)2-3-17(7)20(18,19)12-10(14)5-8(13)6-11(12)15/h5-7,9H,2-4,16H2,1H3 |
| InChIKey | HDMBTZYUBWWKLV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |