C17H19ClN2O4S2 — CID 6503563
N-(5-chloro-2-hydroxyphenyl)-4-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxamide (PubChem CID 6503563) has the molecular formula C17H19ClN2O4S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-4-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-4-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503563 |
| Molecular Formula | C17H19ClN2O4S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-4-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxamide |
| SMILES | CC1CCCN(S(=O)(=O)c2csc(C(=O)Nc3cc(Cl)ccc3O)c2)C1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-11-3-2-6-20(9-11)26(23,24)13-8-16(25-10-13)17(22)19-14-7-12(18)4-5-15(14)21/h4-5,7-8,10-11,21H,2-3,6,9H2,1H3,(H,19,22) |
| InChIKey | IQECMJDTXTXLBN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|