C18H31NO5 — CID 54144171
6-[(4-butan-2-ylphenyl)methyl-methylamino]hexane-1,2,3,4,5-pentol (PubChem CID 54144171) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is 6-[(4-butan-2-ylphenyl)methyl-methylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[(4-butan-2-ylphenyl)methyl-methylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 54144171 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 6-[(4-butan-2-ylphenyl)methyl-methylamino]hexane-1,2,3,4,5-pentol |
| SMILES | CCC(C)c1ccc(CN(C)CC(O)C(O)C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C18H31NO5/c1-4-12(2)14-7-5-13(6-8-14)9-19(3)10-15(21)17(23)18(24)16(22)11-20/h5-8,12,15-18,20-24H,4,9-11H2,1-3H3 |
| InChIKey | ODEOECGVWOPKGJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |