C16H19NO3 — CID 22005903
4-[2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 22005903) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 22005903 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-[2-[benzyl(methyl)amino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | CN(Cc1ccccc1)CC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H19NO3/c1-17(10-12-5-3-2-4-6-12)11-16(20)13-7-8-14(18)15(19)9-13/h2-9,16,18-20H,10-11H2,1H3 |
| InChIKey | YENHZTNWVCNPRW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|