C16H19NO2 — CID 71313919
3-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]phenol (PubChem CID 71313919) has the molecular formula C16H19NO2 and a molecular weight of 260.35 g/mol. Its IUPAC name is 3-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]phenol.
| Compound Name | 3-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 71313919 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[2-[benzyl(trideuteriomethyl)amino]-1-hydroxyethyl]phenol |
| SMILES | [2H]C([2H])([2H])N(Cc1ccccc1)CC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H19NO2/c1-17(11-13-6-3-2-4-7-13)12-16(19)14-8-5-9-15(18)10-14/h2-10,16,18-19H,11-12H2,1H3/i1D3 |
| InChIKey | JBBZPOHBHNEKIM-FIBGUPNXSA-N |
| XLogP | 2.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |