C10H13NO4 — CID 67420413
[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylcarbamic acid (PubChem CID 67420413) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is [2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylcarbamic acid.
| Compound Name | [2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67420413 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylcarbamic acid |
| SMILES | CN(CC(O)c1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C10H13NO4/c1-11(10(14)15)6-9(13)7-3-2-4-8(12)5-7/h2-5,9,12-13H,6H2,1H3,(H,14,15) |
| InChIKey | NBGBCUMYNWUYOL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |