C14H22NO2W- — CID 59694940
N-(2-hydroxy-2-phenylethyl)-N-methylacetamide;propane;tungsten (PubChem CID 59694940) has the molecular formula C14H22NO2W- and a molecular weight of 420.18 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-N-methylacetamide;propane;tungsten.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-N-methylacetamide;propane;tungsten |
|---|---|
| PubChem CID | 59694940 |
| Molecular Formula | C14H22NO2W- |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-N-methylacetamide;propane;tungsten |
| SMILES | CC(=O)N(C)CC(O)c1ccccc1.C[CH-]C.[W] |
| InChI | InChI=1S/C11H15NO2.C3H7.W/c1-9(13)12(2)8-11(14)10-6-4-3-5-7-10;1-3-2;/h3-7,11,14H,8H2,1-2H3;3H,1-2H3;/q;-1; |
| InChIKey | YMNSBUZQEDCRPC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|