C19H24O4S2 — CID 11111703
(2S,3S,4R)-5,5-bis(benzylsulfanyl)pentane-1,2,3,4-tetrol (PubChem CID 11111703) has the molecular formula C19H24O4S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2S,3S,4R)-5,5-bis(benzylsulfanyl)pentane-1,2,3,4-tetrol.
| Compound Name | (2S,3S,4R)-5,5-bis(benzylsulfanyl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11111703 |
| Molecular Formula | C19H24O4S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2S,3S,4R)-5,5-bis(benzylsulfanyl)pentane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)C(SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C19H24O4S2/c20-11-16(21)17(22)18(23)19(24-12-14-7-3-1-4-8-14)25-13-15-9-5-2-6-10-15/h1-10,16-23H,11-13H2/t16-,17-,18+/m0/s1 |
| InChIKey | BEZCZIJEWKDEGU-OKZBNKHCSA-N |
| XLogP | 2.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|