C17H22N2S2 — CID 40537021
[(1S)-1-(2-phenylpyrrol-1-yl)ethyl] N,N-diethylcarbamodithioate (PubChem CID 40537021) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is [(1S)-1-(2-phenylpyrrol-1-yl)ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1S)-1-(2-phenylpyrrol-1-yl)ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 40537021 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [(1S)-1-(2-phenylpyrrol-1-yl)ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C)n1cccc1-c1ccccc1 |
| InChI | InChI=1S/C17H22N2S2/c1-4-18(5-2)17(20)21-14(3)19-13-9-12-16(19)15-10-7-6-8-11-15/h6-14H,4-5H2,1-3H3/t14-/m0/s1 |
| InChIKey | SGNXKDBLOHAFAH-AWEZNQCLSA-N |
| XLogP | 5.03 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|